Products 352438-71-2
CAS 352438-71-2 appears in our catalog under these names: Acetaldehyde Diethyl Acetal-d4, Acetaldehyde-d4 Diethyl Acetal, 98 atom % D, min 98% Chemical Purity, Ethane–1，1，1，2–d4，2，2–diethoxy– (9CI). Offered by: TRC, CDN, GLPBio. Available pack sizes: 100mg, 50mg, 0,5g, 0,25g, 25mg.
1,1,1,2-tetradeuterio-2,2-diethoxyethane (CAS 352438-71-2) is a chemical compound with the molecular formula C6H14O2 and a molecular weight of 122.20 g/mol. IUPAC name: 1,1,1,2-tetradeuterio-2,2-diethoxyethane. InChIKey: DHKHKXVYLBGOIT-SHUFXSSCSA-N.
| Molecular formula | C6H14O2 |
|---|---|
| Molecular weight | 122.20 g/mol |
| IUPAC name | 1,1,1,2-tetradeuterio-2,2-diethoxyethane |
| InChIKey | DHKHKXVYLBGOIT-SHUFXSSCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(OCC)OCC |
Computed by PubChem (NCBI)