CAS 352438-84-7 appears in our catalog under these names: (S)-(+)-2-Amino-1-propanol-3,3,3-d3, 99 atom % D, min 97% Chemical Purity, S(+)–2–AMINO–1–PROPANOL–3,3,3–D3, L-Alaninol-d3, 98.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 100mg, 5 mg, 25 mg, 10 mg.
(2S)-2-amino-3,3,3-trideuteriopropan-1-ol (CAS 352438-84-7) is a chemical compound with the molecular formula C3H9NO and a molecular weight of 78.13 g/mol. IUPAC name: (2S)-2-amino-3,3,3-trideuteriopropan-1-ol. InChIKey: BKMMTJMQCTUHRP-SRQSVDBESA-N.
| Molecular formula | C3H9NO |
|---|---|
| Molecular weight | 78.13 g/mol |
| IUPAC name | (2S)-2-amino-3,3,3-trideuteriopropan-1-ol |
| InChIKey | BKMMTJMQCTUHRP-SRQSVDBESA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](CO)N |
Computed by PubChem (NCBI)