CAS 352439-08-8 appears in our catalog under these names: 2,4,6-Trichloroanisole D5, 2,4,6-Trichloroanisole D5 100 µg/mL in Acetonitrile, 2,4,6-Trichloroanisole D5 100 µg/mL in Methanol, 2,4,6-Trichloroanisole-d5, 98 atom % D, min 98% Chemical Purity, 2,4,6-Trichloroanisole-d5. Offered by: Dr. Ehrenstorfer, CDN, TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 25mg, 1ml, 0,1g, 0,05g, 10mg, 1mg, 5mg, 50MG.
1,3,5-trichloro-2,4-dideuterio-6-(trideuteriomethoxy)benzene (CAS 352439-08-8) is a chemical compound with the molecular formula C7H5Cl3O and a molecular weight of 216.5 g/mol. IUPAC name: 1,3,5-trichloro-2,4-dideuterio-6-(trideuteriomethoxy)benzene. InChIKey: WCVOGSZTONGSQY-RHIBPKLGSA-N.
| Molecular formula | C7H5Cl3O |
|---|---|
| Molecular weight | 216.5 g/mol |
| IUPAC name | 1,3,5-trichloro-2,4-dideuterio-6-(trideuteriomethoxy)benzene |
| InChIKey | WCVOGSZTONGSQY-RHIBPKLGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)OC([2H])([2H])[2H])Cl)[2H])Cl |
Computed by PubChem (NCBI)