Products 352513-86-1
CAS 352513-86-1 is the registry number for TCB-32. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg, 25 mg.
1-N,3-N-bis[3,5-bis(N-carbamimidamido-C-methylcarbonimidoyl)phenyl]benzene-1,3-dicarboxamide (CAS 352513-86-1) is a chemical compound with the molecular formula C32H40N18O2 and a molecular weight of 708.8 g/mol. IUPAC name: 1-N,3-N-bis[3,5-bis(N-carbamimidamido-C-methylcarbonimidoyl)phenyl]benzene-1,3-dicarboxamide. InChIKey: NKGLJTITEFZKAN-UHFFFAOYSA-N.
| Molecular formula | C32H40N18O2 |
|---|---|
| Molecular weight | 708.8 g/mol |
| IUPAC name | 1-N,3-N-bis[3,5-bis(N-carbamimidamido-C-methylcarbonimidoyl)phenyl]benzene-1,3-dicarboxamide |
| InChIKey | NKGLJTITEFZKAN-UHFFFAOYSA-N |
| SMILES | CC(=NNC(=N)N)C1=CC(=CC(=C1)NC(=O)C2=CC(=CC=C2)C(=O)NC3=CC(=CC(=C3)C(=NNC(=N)N)C)C(=NNC(=N)N)C)C(=NNC(=N)N)C |
Computed by PubChem (NCBI)
Synonyms:
Kinome_1855, orb3173726