Products 352521-59-6

CAS 352521-59-6 is the registry number for 1-Ethyl-4-methyl-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-ethyl-4-methylindole (CAS 352521-59-6) is a chemical compound with the molecular formula C11H13N and a molecular weight of 159.23 g/mol. IUPAC name: 1-ethyl-4-methylindole. InChIKey: KGYWNFIJXJVHIL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13N
Molecular weight159.23 g/mol
IUPAC name1-ethyl-4-methylindole
InChIKeyKGYWNFIJXJVHIL-UHFFFAOYSA-N
SMILESCCN1C=CC2=C(C=CC=C21)C

Computed by PubChem (NCBI)