CAS 352525-09-8 is the registry number for N-(L-Phenylalanyl)-2-aminoacridone. Offered by: TRC. Available pack sizes: 500mg.
(2S)-2-amino-N-(9-oxo-10H-acridin-2-yl)-3-phenylpropanamide (CAS 352525-09-8) is a chemical compound with the molecular formula C22H19N3O2 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-amino-N-(9-oxo-10H-acridin-2-yl)-3-phenylpropanamide. InChIKey: WINNAKHIQUIPDH-SFHVURJKSA-N.
| Molecular formula | C22H19N3O2 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-amino-N-(9-oxo-10H-acridin-2-yl)-3-phenylpropanamide |
| InChIKey | WINNAKHIQUIPDH-SFHVURJKSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NC2=CC3=C(C=C2)NC4=CC=CC=C4C3=O)N |
Computed by PubChem (NCBI)