CAS 352525-17-8 is the registry number for 4-(Trifluoromethyl)umbelliferyl phosphate. Offered by: Chemat. Available pack sizes: 100mg, 500mg.
Disodium;[2-oxo-4-(trifluoromethyl)chromen-7-yl] phosphate (CAS 352525-17-8) is a chemical compound with the molecular formula C10H4F3Na2O6P and a molecular weight of 354.08 g/mol. IUPAC name: disodium;[2-oxo-4-(trifluoromethyl)chromen-7-yl] phosphate. InChIKey: MZCZARQEYVOTOS-UHFFFAOYSA-L.
| Molecular formula | C10H4F3Na2O6P |
|---|---|
| Molecular weight | 354.08 g/mol |
| IUPAC name | disodium;[2-oxo-4-(trifluoromethyl)chromen-7-yl] phosphate |
| InChIKey | MZCZARQEYVOTOS-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=C1OP(=O)([O-])[O-])OC(=O)C=C2C(F)(F)F.[Na+].[Na+] |
Computed by PubChem (NCBI)