CAS 352530-36-0 appears in our catalog under these names: (2–Chloro–5–pyridyl)Methylzinc chloride, (2-CHLORO-5-PYRIDYL)METHYLZINC CHLORIDE&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 50ML.
2-chloro-5-methanidylpyridine;chlorozinc(1+) (CAS 352530-36-0) is a chemical compound with the molecular formula C6H5Cl2NZn and a molecular weight of 227.4 g/mol. IUPAC name: 2-chloro-5-methanidylpyridine;chlorozinc(1+). InChIKey: PQSXTBMHLNJQKD-UHFFFAOYSA-M.
| Molecular formula | C6H5Cl2NZn |
|---|---|
| Molecular weight | 227.4 g/mol |
| IUPAC name | 2-chloro-5-methanidylpyridine;chlorozinc(1+) |
| InChIKey | PQSXTBMHLNJQKD-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=CN=C(C=C1)Cl.Cl[Zn+] |
Computed by PubChem (NCBI)