CAS 352530-38-2 is the registry number for 5-ETHOXYCARBONYL-2-FUFURYLZINC CHLORIDE&. Offered by: Sigma-Aldrich. Available pack sizes: 50ML.
Chlorozinc(1+);ethyl 5-methanidylfuran-2-carboxylate (CAS 352530-38-2) is a chemical compound with the molecular formula C8H9ClO3Zn and a molecular weight of 254.0 g/mol. IUPAC name: chlorozinc(1+);ethyl 5-methanidylfuran-2-carboxylate. InChIKey: FKYZYKYRMOCCNS-UHFFFAOYSA-M.
| Molecular formula | C8H9ClO3Zn |
|---|---|
| Molecular weight | 254.0 g/mol |
| IUPAC name | chlorozinc(1+);ethyl 5-methanidylfuran-2-carboxylate |
| InChIKey | FKYZYKYRMOCCNS-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C1=CC=C(O1)[CH2-].Cl[Zn+] |
Computed by PubChem (NCBI)