CAS 352534-75-9 appears in our catalog under these names: 2,3,4,5,6–Pentafluorobenzylzinc bromide solution, 2,3,4,5,6-PENTAFLUOROBENZYLZINC BROMIDE&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 250ml, 50ML.
Bromozinc(1+);1,2,3,4,5-pentafluoro-6-methanidylbenzene (CAS 352534-75-9) is a chemical compound with the molecular formula C7H2BrF5Zn and a molecular weight of 326.4 g/mol. IUPAC name: bromozinc(1+);1,2,3,4,5-pentafluoro-6-methanidylbenzene. InChIKey: JNQVFPNRJUXZSW-UHFFFAOYSA-M.
| Molecular formula | C7H2BrF5Zn |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | bromozinc(1+);1,2,3,4,5-pentafluoro-6-methanidylbenzene |
| InChIKey | JNQVFPNRJUXZSW-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=C(C(=C(C(=C1F)F)F)F)F.[Zn+]Br |
Computed by PubChem (NCBI)