CAS 35263-20-8 is the registry number for 6-Chloro-3-(2-furyl)[1,2,4]triazolo[4,3-b]pyridazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-chloro-3-(furan-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 35263-20-8) is a chemical compound with the molecular formula C9H5ClN4O and a molecular weight of 220.61 g/mol. IUPAC name: 6-chloro-3-(furan-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: DKIRHRYJCPVVMS-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN4O |
|---|---|
| Molecular weight | 220.61 g/mol |
| IUPAC name | 6-chloro-3-(furan-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | DKIRHRYJCPVVMS-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)