Products 35266-82-1

CAS 35266-82-1 is the registry number for (E)-((3,7-Dimethylocta-2,6-dien-1-yl)oxy)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

[(2E)-3,7-dimethylocta-2,6-dienoxy]benzene (CAS 35266-82-1) is a chemical compound with the molecular formula C16H22O and a molecular weight of 230.34 g/mol. IUPAC name: [(2E)-3,7-dimethylocta-2,6-dienoxy]benzene. InChIKey: OSNYSUVPOZLCFR-NTCAYCPXSA-N.

Identity
Molecular formulaC16H22O
Molecular weight230.34 g/mol
IUPAC name[(2E)-3,7-dimethylocta-2,6-dienoxy]benzene
InChIKeyOSNYSUVPOZLCFR-NTCAYCPXSA-N
SMILESCC(=CCC/C(=C/COC1=CC=CC=C1)/C)C

Computed by PubChem (NCBI)