CAS 35282-78-1 appears in our catalog under these names: Celecoxib Impurity 27, Celecoxib Impurity 16, Parecoxib Impurity 61. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-sulfamoylbenzenediazonium chloride (CAS 35282-78-1) is a chemical compound with the molecular formula C6H6ClN3O2S and a molecular weight of 219.65 g/mol. IUPAC name: 4-sulfamoylbenzenediazonium chloride. InChIKey: BCVPKCRRZVARRB-UHFFFAOYSA-M.
| Molecular formula | C6H6ClN3O2S |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | 4-sulfamoylbenzenediazonium chloride |
| InChIKey | BCVPKCRRZVARRB-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1[N+]#N)S(=O)(=O)N.[Cl-] |
Computed by PubChem (NCBI)