CAS 3530-19-6 appears in our catalog under these names: Direct scarlet B, tech grade, Direct Scarlet B (Technical Grade), Direct Scarlet B. Offered by: Combi-blocks, TRC, Chemat. Available pack sizes: 25g, 5g, 1g, 2,5g, 250mg, 500mg.
Disodium;8-[[4-[4-[(4-ethoxyphenyl)diazenyl]phenyl]phenyl]diazenyl]-7-hydroxynaphthalene-1,3-disulfonate (CAS 3530-19-6) is a chemical compound with the molecular formula C30H22N4Na2O8S2 and a molecular weight of 676.6 g/mol. IUPAC name: disodium;8-[[4-[4-[(4-ethoxyphenyl)diazenyl]phenyl]phenyl]diazenyl]-7-hydroxynaphthalene-1,3-disulfonate. InChIKey: PHOZXQMVPWPNAP-UHFFFAOYSA-L.
| Molecular formula | C30H22N4Na2O8S2 |
|---|---|
| Molecular weight | 676.6 g/mol |
| IUPAC name | disodium;8-[[4-[4-[(4-ethoxyphenyl)diazenyl]phenyl]phenyl]diazenyl]-7-hydroxynaphthalene-1,3-disulfonate |
| InChIKey | PHOZXQMVPWPNAP-UHFFFAOYSA-L |
| SMILES | CCOC1=CC=C(C=C1)N=NC2=CC=C(C=C2)C3=CC=C(C=C3)N=NC4=C(C=CC5=CC(=CC(=C54)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)