CAS 353229-59-1 appears in our catalog under these names: LY 487379 Hydrochloride, >95% (HPLC), LY 487379 hydrochloride, LY487379 hydrochloride, LY 487379-d3 Hydrochloride, LY487379 (hydrochloride). Offered by: TRC, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 50mg, 5mg, 100mg.
2,2,2-trifluoro-N-[4-(2-methoxyphenoxy)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide;hydrochloride (CAS 353229-59-1) is a chemical compound with the molecular formula C21H20ClF3N2O4S and a molecular weight of 488.9 g/mol. IUPAC name: 2,2,2-trifluoro-N-[4-(2-methoxyphenoxy)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide;hydrochloride. InChIKey: LPWFRDWTOKLHJC-UHFFFAOYSA-N.
| Molecular formula | C21H20ClF3N2O4S |
|---|---|
| Molecular weight | 488.9 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[4-(2-methoxyphenoxy)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide;hydrochloride |
| InChIKey | LPWFRDWTOKLHJC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OC2=CC=C(C=C2)N(CC3=CN=CC=C3)S(=O)(=O)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)