CAS 353245-98-4 appears in our catalog under these names: Fmoc-l-beta-homotryptophan, 97%, Fmoc–L–β–Homo–Trp–OH, Fmoc-L-beta-HTrp-OH, (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(1H-indol-3-yl)butanoic acid, 97%, 97%, Fmoc-L-β-Homo-Trp-OH, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(1H-indol-3-yl)butanoic acid (CAS 353245-98-4) is a chemical compound with the molecular formula C27H24N2O4 and a molecular weight of 440.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(1H-indol-3-yl)butanoic acid. InChIKey: SXHPYIHTNVXINO-SFHVURJKSA-N.
| Molecular formula | C27H24N2O4 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(1H-indol-3-yl)butanoic acid |
| InChIKey | SXHPYIHTNVXINO-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=CC=CC=C54)CC(=O)O |
Computed by PubChem (NCBI)