Products 353250-09-6
CAS 353250-09-6 is the registry number for ERK2 IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-benzyl-4-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-1H-pyrrole-2-carboxamide (CAS 353250-09-6) is a chemical compound with the molecular formula C21H17ClN4O and a molecular weight of 376.8 g/mol. IUPAC name: N-benzyl-4-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-1H-pyrrole-2-carboxamide. InChIKey: PDJZASCRQRBYQS-UHFFFAOYSA-N.
| Molecular formula | C21H17ClN4O |
|---|---|
| Molecular weight | 376.8 g/mol |
| IUPAC name | N-benzyl-4-[4-(3-chlorophenyl)-1H-pyrazol-5-yl]-1H-pyrrole-2-carboxamide |
| InChIKey | PDJZASCRQRBYQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC(=CN2)C3=C(C=NN3)C4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)