CAS 353256-64-1 appears in our catalog under these names: 2-[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]-3-nitropyridine, 95%, 2-Methyl-5-((3-nitropyridin-2-yl)thio)-1,3,4-thiadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g, 5g.
2-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazole (CAS 353256-64-1) is a chemical compound with the molecular formula C8H6N4O2S2 and a molecular weight of 254.3 g/mol. IUPAC name: 2-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazole. InChIKey: KVMNTVFDQCRUMR-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 2-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazole |
| InChIKey | KVMNTVFDQCRUMR-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(S1)SC2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)