CAS 353270-76-5 appears in our catalog under these names: Methyl Efavirenz (Mixture of Diastereomers), Methyl efavirenz, rac Methyl Efavirenz (Mixture of Diastereomers). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg.
(4S)-6-chloro-4-[2-(2-methylcyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 353270-76-5) is a chemical compound with the molecular formula C15H11ClF3NO2 and a molecular weight of 329.70 g/mol. IUPAC name: (4S)-6-chloro-4-[2-(2-methylcyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: VTRDGEWILKMMRP-CTCYHXBNSA-N.
| Molecular formula | C15H11ClF3NO2 |
|---|---|
| Molecular weight | 329.70 g/mol |
| IUPAC name | (4S)-6-chloro-4-[2-(2-methylcyclopropyl)ethynyl]-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | VTRDGEWILKMMRP-CTCYHXBNSA-N |
| SMILES | CC1CC1C#C[C@]2(C3=C(C=CC(=C3)Cl)NC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)