CAS 35342-88-2 is the registry number for N,O-BIS(TRIMETHYLSILYL)CARBAMATE, >=98&. Offered by: Sigma-Aldrich. Available pack sizes: 10G.
Trimethylsilyl N-trimethylsilylcarbamate (CAS 35342-88-2) is a chemical compound with the molecular formula C7H19NO2Si2 and a molecular weight of 205.40 g/mol. IUPAC name: trimethylsilyl N-trimethylsilylcarbamate. InChIKey: DGIJAZGPLFOQJE-UHFFFAOYSA-N.
| Molecular formula | C7H19NO2Si2 |
|---|---|
| Molecular weight | 205.40 g/mol |
| IUPAC name | trimethylsilyl N-trimethylsilylcarbamate |
| InChIKey | DGIJAZGPLFOQJE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)NC(=O)O[Si](C)(C)C |
Computed by PubChem (NCBI)