Products 353484-02-3
CAS 353484-02-3 is the registry number for iBFAR2. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg.
4-(4-nitrophenyl)-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (CAS 353484-02-3) is a chemical compound with the molecular formula C19H15F3N2O2 and a molecular weight of 360.3 g/mol. IUPAC name: 4-(4-nitrophenyl)-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline. InChIKey: VJDUKWHSBOBGIY-UHFFFAOYSA-N.
| Molecular formula | C19H15F3N2O2 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-6-(trifluoromethyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| InChIKey | VJDUKWHSBOBGIY-UHFFFAOYSA-N |
| SMILES | C1C=CC2C1C(NC3=C2C=CC=C3C(F)(F)F)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)