CAS 3535-83-9 appears in our catalog under these names: Tetraheptylammonium iodide, 98%, Tetraheptylammonium Iodide, Tetraheptylammonium (iodide), 98.0%, Tetraheptylammoniumiodide, 98%, 98%. Offered by: Combi-blocks, GLPBio, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 25 g, 5 g, 10 g.
Tetraheptylazanium iodide (CAS 3535-83-9) is a chemical compound with the molecular formula C28H60IN and a molecular weight of 537.7 g/mol. IUPAC name: tetraheptylazanium iodide. InChIKey: KCSOHLKZTZMKQA-UHFFFAOYSA-M.
| Molecular formula | C28H60IN |
|---|---|
| Molecular weight | 537.7 g/mol |
| IUPAC name | tetraheptylazanium iodide |
| InChIKey | KCSOHLKZTZMKQA-UHFFFAOYSA-M |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[I-] |
Computed by PubChem (NCBI)