CAS 353503-13-6 is the registry number for N-(3,5-bis(trifluoromethyl)phenyl)-2-phenoxyethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[3,5-bis(trifluoromethyl)phenyl]-2-phenoxyacetamide (CAS 353503-13-6) is a chemical compound with the molecular formula C16H11F6NO2 and a molecular weight of 363.25 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]-2-phenoxyacetamide. InChIKey: SNBICZFIYMHDNT-UHFFFAOYSA-N.
| Molecular formula | C16H11F6NO2 |
|---|---|
| Molecular weight | 363.25 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]-2-phenoxyacetamide |
| InChIKey | SNBICZFIYMHDNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)