CAS 353519-63-8 appears in our catalog under these names: Hlm006474, 95%, HLM006474/ 99.04% (existing batch purity), E2F Inhibitor, HLM006474, HLM006474 98+%, HLM 006474, 98+%, 98+%. Offered by: Combi-blocks, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 2mg, 5mg, 10mg, 25mg, 50mg.
7-[(4-ethoxy-3-methylphenyl)-(pyridin-2-ylamino)methyl]-2-methylquinolin-8-ol (CAS 353519-63-8) is a chemical compound with the molecular formula C25H25N3O2 and a molecular weight of 399.5 g/mol. IUPAC name: 7-[(4-ethoxy-3-methylphenyl)-(pyridin-2-ylamino)methyl]-2-methylquinolin-8-ol. InChIKey: CYNZBLNMIJNBSF-UHFFFAOYSA-N.
| Molecular formula | C25H25N3O2 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 7-[(4-ethoxy-3-methylphenyl)-(pyridin-2-ylamino)methyl]-2-methylquinolin-8-ol |
| InChIKey | CYNZBLNMIJNBSF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(C2=C(C3=C(C=CC(=N3)C)C=C2)O)NC4=CC=CC=N4)C |
Computed by PubChem (NCBI)