Products 3538-69-0
CAS 3538-69-0 is the registry number for Cinnamohydrazide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-phenylprop-2-enehydrazide (CAS 3538-69-0) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: (E)-3-phenylprop-2-enehydrazide. InChIKey: MTWDGUWQZYXGTQ-VOTSOKGWSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | (E)-3-phenylprop-2-enehydrazide |
| InChIKey | MTWDGUWQZYXGTQ-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NN |
Computed by PubChem (NCBI)
Synonyms:
CINNAMIC ACID, HYDRAZIDE, Cinnamoylhydrazine, Cinnamoyl hydrazide, 2-Propenoic acid, 3-phenyl-, hydrazide, 2-Propenoic acid, 3-phenyl-, hydrazide (9CI), 4-09-00-02028 (Beilstein Handbook Reference), (E)-3-phenylprop-2-enehydrazide, Cinnamohydrazide, trans-cinnamic acid hydrazide, (2E)-3-phenylprop-2-enohydrazide