CAS 354-96-1 is the registry number for 1,1,1,2,3,4,4,4-Octafluoro-2,3-Bis(Trifluoromethyl)Butane. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.
1,1,1,2,3,4,4,4-octafluoro-2,3-bis(trifluoromethyl)butane (CAS 354-96-1) is a chemical compound with the molecular formula C6F14 and a molecular weight of 338.04 g/mol. IUPAC name: 1,1,1,2,3,4,4,4-octafluoro-2,3-bis(trifluoromethyl)butane. InChIKey: NBQYGIPVNCVJJP-UHFFFAOYSA-N.
| Molecular formula | C6F14 |
|---|---|
| Molecular weight | 338.04 g/mol |
| IUPAC name | 1,1,1,2,3,4,4,4-octafluoro-2,3-bis(trifluoromethyl)butane |
| InChIKey | NBQYGIPVNCVJJP-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(C(F)(F)F)F)(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)