CAS 354153-47-2 appears in our catalog under these names: 1-(2,4,6-Trimethylphenyl)ethane-1,2-diol, 95%, 1-(2,4,6-Trimethylphenyl)ethane-1,2-diol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2,4,6-trimethylphenyl)ethane-1,2-diol (CAS 354153-47-2) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 180.24 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)ethane-1,2-diol. InChIKey: JXHICCPIVYTCHE-UHFFFAOYSA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 180.24 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)ethane-1,2-diol |
| InChIKey | JXHICCPIVYTCHE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(CO)O)C |
Computed by PubChem (NCBI)