CAS 35438-81-4 appears in our catalog under these names: Rac-(3ar,4r,7as)-4-methyl-1,3,3a,4,7,7a-hexahydro-2-benzofuran-1,3-dione, 95%, rac-(3aR,4R,7aS)-4-Methyl-1,3,3a,4,7,7a-hexahydro-2-benzofuran-1,3-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,25g, 2,5g.
(3aR,4R,7aS)-4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (CAS 35438-81-4) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: (3aR,4R,7aS)-4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione. InChIKey: XPEKVUUBSDFMDR-DSYKOEDSSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | (3aR,4R,7aS)-4-methyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| InChIKey | XPEKVUUBSDFMDR-DSYKOEDSSA-N |
| SMILES | C[C@@H]1C=CC[C@H]2[C@@H]1C(=O)OC2=O |
Computed by PubChem (NCBI)