CAS 35440-36-9 appears in our catalog under these names: Fenoprofen Acyl Glucuronide (Mixture of Diastereomers), Fenoprofen acyl-β-D-glucuronide. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10mg, 1mg, 25mg, 5mg.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(2-phenoxyphenyl)propanoyloxy]oxane-2-carboxylic acid (CAS 35440-36-9) is a chemical compound with the molecular formula C21H22O9 and a molecular weight of 418.4 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(2-phenoxyphenyl)propanoyloxy]oxane-2-carboxylic acid. InChIKey: OUSPEHIWFXFVNC-RVLIQFCMSA-N.
| Molecular formula | C21H22O9 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(2-phenoxyphenyl)propanoyloxy]oxane-2-carboxylic acid |
| InChIKey | OUSPEHIWFXFVNC-RVLIQFCMSA-N |
| SMILES | CC(C1=CC=CC=C1OC2=CC=CC=C2)C(=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)