CAS 35444-94-1 appears in our catalog under these names: 4-Iododiphenylmethane, 98%, 4-Iododiphenylmethane. Offered by: AmBeed, Biosynth. Available pack sizes: 25g, 5g.
1-benzyl-4-iodobenzene (CAS 35444-94-1) is a chemical compound with the molecular formula C13H11I and a molecular weight of 294.13 g/mol. IUPAC name: 1-benzyl-4-iodobenzene. InChIKey: FCUNNMLRHRWXAM-UHFFFAOYSA-N.
| Molecular formula | C13H11I |
|---|---|
| Molecular weight | 294.13 g/mol |
| IUPAC name | 1-benzyl-4-iodobenzene |
| InChIKey | FCUNNMLRHRWXAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)