Products 3545-67-3
CAS 3545-67-3 appears in our catalog under these names: Chloroquine dihydrochloride, Chloroquine (dihydrochloride), 99.61%, Chloroquine (dihydrochloride) (Standard), Chloroquine dihydrochloride, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 50mg, 50 mg, 10mM/1mL, 25 mg, 5 mg, 10 mg, 100 mg, 25mg.
4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride (CAS 3545-67-3) is a chemical compound with the molecular formula C18H28Cl3N3 and a molecular weight of 392.8 g/mol. IUPAC name: 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride. InChIKey: PCFGECQRSMVKCC-UHFFFAOYSA-N.
| Molecular formula | C18H28Cl3N3 |
|---|---|
| Molecular weight | 392.8 g/mol |
| IUPAC name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;dihydrochloride |
| InChIKey | PCFGECQRSMVKCC-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Chloroquine hydrochloride, Aralen hydrochloride, 7-(Chloro-4-((4-diethylamino)-1-methylbutyl)amino)quinoline dihydrochloride, CHLOROQUINE HYDROCHLORIDE (MART.), CHLOROQUINE HYDROCHLORIDE [MART.], CHLOROQUINE HYDROCHLORIDE (USP IMPURITY), CHLOROQUINE HYDROCHLORIDE [USP IMPURITY], 7-(Chloro-4-[[4-diethylamino)-1-methylbutyl]amino]quinoline dihydrochloride, Chloroquine dihydrochloride, Chloroquine HCl