CAS 354562-75-7 is the registry number for 5,6-Dimethyl-2-(thiophen-2-yl)thieno[2,3-d]pyrimidin-4(3H)-one, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg, 500mg.
5,6-dimethyl-2-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 354562-75-7) is a chemical compound with the molecular formula C12H10N2OS2 and a molecular weight of 262.4 g/mol. IUPAC name: 5,6-dimethyl-2-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: PXOKBYJGEFZQNS-UHFFFAOYSA-N.
| Molecular formula | C12H10N2OS2 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 5,6-dimethyl-2-thiophen-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | PXOKBYJGEFZQNS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)NC(=N2)C3=CC=CS3)C |
Computed by PubChem (NCBI)