Products 354784-03-5
CAS 354784-03-5 appears in our catalog under these names: BoNT–IN–2, BoNT-IN-2, 98.0%, BoNT-IN-2. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 5 mg, 10 mg.
7-[[4-(dimethylamino)phenyl]-[(6-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol (CAS 354784-03-5) is a chemical compound with the molecular formula C25H26N4O and a molecular weight of 398.5 g/mol. IUPAC name: 7-[[4-(dimethylamino)phenyl]-[(6-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol. InChIKey: HOCWFUDKLDDDRQ-UHFFFAOYSA-N.
| Molecular formula | C25H26N4O |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 7-[[4-(dimethylamino)phenyl]-[(6-methyl-2-pyridinyl)amino]methyl]-2-methylquinolin-8-ol |
| InChIKey | HOCWFUDKLDDDRQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC(C2=CC=C(C=C2)N(C)C)C3=C(C4=C(C=CC(=N4)C)C=C3)O |
Computed by PubChem (NCBI)