Products 354815-43-3
CAS 354815-43-3 is the registry number for Androgen receptor antagonist 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
12-(4-chlorophenyl)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaene (CAS 354815-43-3) is a chemical compound with the molecular formula C22H18ClN and a molecular weight of 331.8 g/mol. IUPAC name: 12-(4-chlorophenyl)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaene. InChIKey: UKVXEQUUZSTQOW-UHFFFAOYSA-N.
| Molecular formula | C22H18ClN |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 12-(4-chlorophenyl)-11-azatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,8,15-hexaene |
| InChIKey | UKVXEQUUZSTQOW-UHFFFAOYSA-N |
| SMILES | C1C=CC2C1C(NC3=C2C4=CC=CC=C4C=C3)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)