CAS 355-27-1 appears in our catalog under these names: 1H,1H-Perfluoropentylamine, 95%, 1H,1H-Nonafluoropentylamine, 1H,1H-Perfluoropentylamine, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 25g, 5g, 2g.
2,2,3,3,4,4,5,5,5-nonafluoropentan-1-amine (CAS 355-27-1) is a chemical compound with the molecular formula C5H4F9N and a molecular weight of 249.08 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-amine. InChIKey: SUNUNYBGDFIAME-UHFFFAOYSA-N.
| Molecular formula | C5H4F9N |
|---|---|
| Molecular weight | 249.08 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-amine |
| InChIKey | SUNUNYBGDFIAME-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)