CAS 355-30-6 is the registry number for Nonafluoropentaldehyde hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.
2,2,3,3,4,4,5,5,5-nonafluoropentane-1,1-diol (CAS 355-30-6) is a chemical compound with the molecular formula C5H3F9O2 and a molecular weight of 266.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentane-1,1-diol. InChIKey: OKBXLDZUHBWJBK-UHFFFAOYSA-N.
| Molecular formula | C5H3F9O2 |
|---|---|
| Molecular weight | 266.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoropentane-1,1-diol |
| InChIKey | OKBXLDZUHBWJBK-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(O)O |
Computed by PubChem (NCBI)