CAS 355-40-8 is the registry number for 1,6-Dichloroperfluorohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane (CAS 355-40-8) is a chemical compound with the molecular formula C6Cl2F12 and a molecular weight of 370.95 g/mol. IUPAC name: 1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane. InChIKey: SNCGKZWVZZPGDQ-UHFFFAOYSA-N.
| Molecular formula | C6Cl2F12 |
|---|---|
| Molecular weight | 370.95 g/mol |
| IUPAC name | 1,6-dichloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
| InChIKey | SNCGKZWVZZPGDQ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)Cl)(F)F)(F)F)(C(C(F)(F)Cl)(F)F)(F)F |
Computed by PubChem (NCBI)