CAS 355-47-5 appears in our catalog under these names: 1H,1H-Perfluorononylamine, 95%, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-HEPTAD. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g, 5g, 250mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononan-1-amine (CAS 355-47-5) is a chemical compound with the molecular formula C9H4F17N and a molecular weight of 449.11 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononan-1-amine. InChIKey: IHVFAVFXCUPMEN-UHFFFAOYSA-N.
| Molecular formula | C9H4F17N |
|---|---|
| Molecular weight | 449.11 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononan-1-amine |
| InChIKey | IHVFAVFXCUPMEN-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)