CAS 355-66-8 appears in our catalog under these names: Octafluoroadipamide, 95%, Octafluoroadipamide. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g.
2,2,3,3,4,4,5,5-octafluorohexanediamide (CAS 355-66-8) is a chemical compound with the molecular formula C6H4F8N2O2 and a molecular weight of 288.10 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluorohexanediamide. InChIKey: SVURUIRNGAQISR-UHFFFAOYSA-N.
| Molecular formula | C6H4F8N2O2 |
|---|---|
| Molecular weight | 288.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluorohexanediamide |
| InChIKey | SVURUIRNGAQISR-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(=O)N)(F)F)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)