CAS 355-74-8 appears in our catalog under these names: 2,2,3,3,4,4,5,5–Octafluoro–1,6–hexanediol, 2,2,3,3,4,4,5,5-Octafluoro-1,6-hexanediol, 97% , 2,2,3,3,4,4,5,5-Octafluoro-1,6-hexanediol, 2,2,3,3,4,4,5,5-Octafluoro-1,6-hexanediol, >98.0%(GC), 2,2,3,3,4,4,5,5-Octafluoro-1,6-hexanediol 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 15g, 250mg.
2,2,3,3,4,4,5,5-octafluorohexane-1,6-diol (CAS 355-74-8) is a chemical compound with the molecular formula C6H6F8O2 and a molecular weight of 262.10 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diol. InChIKey: NHEKBXPLFJSSBZ-UHFFFAOYSA-N.
| Molecular formula | C6H6F8O2 |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluorohexane-1,6-diol |
| InChIKey | NHEKBXPLFJSSBZ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(CO)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)