CAS 355-77-1 is the registry number for 1H,1H-Perfluorohexyl p-toluenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 4-methylbenzenesulfonate (CAS 355-77-1) is a chemical compound with the molecular formula C13H9F11O3S and a molecular weight of 454.26 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 4-methylbenzenesulfonate. InChIKey: HDIPCCMMPQAPRF-UHFFFAOYSA-N.
| Molecular formula | C13H9F11O3S |
|---|---|
| Molecular weight | 454.26 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 4-methylbenzenesulfonate |
| InChIKey | HDIPCCMMPQAPRF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)