CAS 355-84-0 is the registry number for 5,5,6,6,7,7,8,8,8-Nonafluorooctane-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5,5,6,6,7,7,8,8,8-nonafluorooctane-2,4-dione (CAS 355-84-0) is a chemical compound with the molecular formula C8H5F9O2 and a molecular weight of 304.11 g/mol. IUPAC name: 5,5,6,6,7,7,8,8,8-nonafluorooctane-2,4-dione. InChIKey: NQPVZXRGQCXFLN-UHFFFAOYSA-N.
| Molecular formula | C8H5F9O2 |
|---|---|
| Molecular weight | 304.11 g/mol |
| IUPAC name | 5,5,6,6,7,7,8,8,8-nonafluorooctane-2,4-dione |
| InChIKey | NQPVZXRGQCXFLN-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)