CAS 355-86-2 appears in our catalog under these names: Tris(1h,1h,5h-octafluoropentyl) phosphate, 95%, Tris(1H,1H,5H–octafluoropentyl) Phosphate, Tris(1H,1H,5H-octafluoropentyl) Phosphate, >95.0%(GC), Tris(1H,1H,5H-octafluoropentyl) Phosphate, ≥95%, ≥95%, Phosphoric acid tris(1H,1H,5H-octafluoro-n-pentyl)ester, 85%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
Tris(2,2,3,3,4,4,5,5-octafluoropentyl) phosphate (CAS 355-86-2) is a chemical compound with the molecular formula C15H9F24O4P and a molecular weight of 740.16 g/mol. IUPAC name: tris(2,2,3,3,4,4,5,5-octafluoropentyl) phosphate. InChIKey: BSOLVVCARHZLMT-UHFFFAOYSA-N.
| Molecular formula | C15H9F24O4P |
|---|---|
| Molecular weight | 740.16 g/mol |
| IUPAC name | tris(2,2,3,3,4,4,5,5-octafluoropentyl) phosphate |
| InChIKey | BSOLVVCARHZLMT-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)F)(F)F)(F)F)(F)F)OP(=O)(OCC(C(C(C(F)F)(F)F)(F)F)(F)F)OCC(C(C(C(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)