CAS 355-95-3 is the registry number for 4,4,5,5,6,6,6-Heptafluoro-2-hexene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,4,5,5,6,6,6-heptafluorohex-2-ene (CAS 355-95-3) is a chemical compound with the molecular formula C6H5F7 and a molecular weight of 210.09 g/mol. IUPAC name: 4,4,5,5,6,6,6-heptafluorohex-2-ene. InChIKey: HVOUHYGSLBPLGT-UHFFFAOYSA-N.
| Molecular formula | C6H5F7 |
|---|---|
| Molecular weight | 210.09 g/mol |
| IUPAC name | 4,4,5,5,6,6,6-heptafluorohex-2-ene |
| InChIKey | HVOUHYGSLBPLGT-UHFFFAOYSA-N |
| SMILES | CC=CC(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)