CAS 355012-89-4 is the registry number for Camphorquinone-10-sulfonic acid hydrate. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg.
[(1S,4S)-7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate (CAS 355012-89-4) is a chemical compound with the molecular formula C10H16O6S and a molecular weight of 264.30 g/mol. IUPAC name: [(1S,4S)-7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate. InChIKey: YEGBEDZBQAKLIO-MIWKYWLESA-N.
| Molecular formula | C10H16O6S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | [(1S,4S)-7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate |
| InChIKey | YEGBEDZBQAKLIO-MIWKYWLESA-N |
| SMILES | CC1([C@@H]2CC[C@]1(C(=O)C2=O)CS(=O)(=O)O)C.O |
Computed by PubChem (NCBI)