CAS 35505-52-3 is the registry number for 2,6-Bis-(trimethylsilyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Trimethyl-(6-trimethylsilyl-2-pyridinyl)silane (CAS 35505-52-3) is a chemical compound with the molecular formula C11H21NSi2 and a molecular weight of 223.46 g/mol. IUPAC name: trimethyl-(6-trimethylsilyl-2-pyridinyl)silane. InChIKey: MIKHDRDLLZXYPU-UHFFFAOYSA-N.
| Molecular formula | C11H21NSi2 |
|---|---|
| Molecular weight | 223.46 g/mol |
| IUPAC name | trimethyl-(6-trimethylsilyl-2-pyridinyl)silane |
| InChIKey | MIKHDRDLLZXYPU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=NC(=CC=C1)[Si](C)(C)C |
Computed by PubChem (NCBI)