CAS 355115-41-2 appears in our catalog under these names: Dansylamidoethyl methanethiosulfonate, 95%, Dansylamidoethyl Methanethiosulfonate, >95% (HPLC), Dansylamidoethyl methanethiosulfonate. Offered by: Combi-blocks, TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 5 mg, 25 mg, 10 mg.
5-(dimethylamino)-N-(2-methylsulfonylsulfanylethyl)naphthalene-1-sulfonamide (CAS 355115-41-2) is a chemical compound with the molecular formula C15H20N2O4S3 and a molecular weight of 388.5 g/mol. IUPAC name: 5-(dimethylamino)-N-(2-methylsulfonylsulfanylethyl)naphthalene-1-sulfonamide. InChIKey: ZKELPZYUWUFQLZ-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4S3 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | 5-(dimethylamino)-N-(2-methylsulfonylsulfanylethyl)naphthalene-1-sulfonamide |
| InChIKey | ZKELPZYUWUFQLZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NCCSS(=O)(=O)C |
Computed by PubChem (NCBI)