Products 35516-73-5

CAS 35516-73-5 is the registry number for Cyprazine-desisopropyl. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 500mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

6-chloro-2-N-cyclopropyl-1,3,5-triazine-2,4-diamine (CAS 35516-73-5) is a chemical compound with the molecular formula C6H8ClN5 and a molecular weight of 185.61 g/mol. IUPAC name: 6-chloro-2-N-cyclopropyl-1,3,5-triazine-2,4-diamine. InChIKey: OFMQRQUUPYBUND-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClN5
Molecular weight185.61 g/mol
IUPAC name6-chloro-2-N-cyclopropyl-1,3,5-triazine-2,4-diamine
InChIKeyOFMQRQUUPYBUND-UHFFFAOYSA-N
SMILESC1CC1NC2=NC(=NC(=N2)N)Cl

Computed by PubChem (NCBI)