CAS 3555-41-7 appears in our catalog under these names: 6,8-Dibromo-3,4-dihydro-quinolin-2-one, 95%, 6,8-Dibromo-3,4-dihydroquinolin-2(1H)-one, 95%, 6,8–Dibromo–3,4–dihydroquinolin–2(1H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25g, 10g.
6,8-dibromo-3,4-dihydro-1H-quinolin-2-one (CAS 3555-41-7) is a chemical compound with the molecular formula C9H7Br2NO and a molecular weight of 304.97 g/mol. IUPAC name: 6,8-dibromo-3,4-dihydro-1H-quinolin-2-one. InChIKey: RSLXXGCJTGCWIZ-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2NO |
|---|---|
| Molecular weight | 304.97 g/mol |
| IUPAC name | 6,8-dibromo-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | RSLXXGCJTGCWIZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=C(C=C2Br)Br |
Computed by PubChem (NCBI)