CAS 3555-45-1 appears in our catalog under these names: Bis(trimethylsiloxy) Diethoxysilane, 3,3-Diethoxy-1,1,1,5,5,5-hexamethyltrisiloxane, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Diethyl bis(trimethylsilyl) silicate (CAS 3555-45-1) is a chemical compound with the molecular formula C10H28O4Si3 and a molecular weight of 296.58 g/mol. IUPAC name: diethyl bis(trimethylsilyl) silicate. InChIKey: QZGNEODXJZDIBK-UHFFFAOYSA-N.
| Molecular formula | C10H28O4Si3 |
|---|---|
| Molecular weight | 296.58 g/mol |
| IUPAC name | diethyl bis(trimethylsilyl) silicate |
| InChIKey | QZGNEODXJZDIBK-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(O[Si](C)(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)